C24H22N2O2S — CID 46566075
(E)-3-[4-(2-oxopyrrolidin-1-yl)phenyl]-N-[phenyl(thiophen-2-yl)methyl]prop-2-enamide (PubChem CID 46566075) has the molecular formula C24H22N2O2S and a molecular weight of 402.52 g/mol. Its IUPAC name is (E)-3-[4-(2-oxopyrrolidin-1-yl)phenyl]-N-[phenyl(thiophen-2-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(2-oxopyrrolidin-1-yl)phenyl]-N-[phenyl(thiophen-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 46566075 |
| Molecular Formula | C24H22N2O2S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | (E)-3-[4-(2-oxopyrrolidin-1-yl)phenyl]-N-[phenyl(thiophen-2-yl)methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(N2CCCC2=O)cc1)NC(c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C24H22N2O2S/c27-22(25-24(21-8-5-17-29-21)19-6-2-1-3-7-19)15-12-18-10-13-20(14-11-18)26-16-4-9-23(26)28/h1-3,5-8,10-15,17,24H,4,9,16H2,(H,25,27)/b15-12+ |
| InChIKey | BQYFSBMSWLENKJ-NTCAYCPXSA-N |
| XLogP | 4.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|