C24H23FN4O2 — CID 55491500
(E)-N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide (PubChem CID 55491500) has the molecular formula C24H23FN4O2 and a molecular weight of 418.47 g/mol. Its IUPAC name is (E)-N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55491500 |
| Molecular Formula | C24H23FN4O2 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | (E)-N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide |
| SMILES | Cn1ccnc1C(NC(=O)/C=C/c1ccc(N2CCCC2=O)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H23FN4O2/c1-28-16-14-26-24(28)23(18-7-9-19(25)10-8-18)27-21(30)13-6-17-4-11-20(12-5-17)29-15-2-3-22(29)31/h4-14,16,23H,2-3,15H2,1H3,(H,27,30)/b13-6+ |
| InChIKey | PIVQGSKGHFVVOY-AWNIVKPZSA-N |
| XLogP | 3.61 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|