C23H19FN4O — CID 18209299
(E)-N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-quinolin-8-ylprop-2-enamide (PubChem CID 18209299) has the molecular formula C23H19FN4O and a molecular weight of 386.43 g/mol. Its IUPAC name is (E)-N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-quinolin-8-ylprop-2-enamide.
| Compound Name | (E)-N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-quinolin-8-ylprop-2-enamide |
|---|---|
| PubChem CID | 18209299 |
| Molecular Formula | C23H19FN4O |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | (E)-N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-quinolin-8-ylprop-2-enamide |
| SMILES | Cn1ccnc1C(NC(=O)/C=C/c1cccc2cccnc12)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H19FN4O/c1-28-15-14-26-23(28)22(18-7-10-19(24)11-8-18)27-20(29)12-9-17-5-2-4-16-6-3-13-25-21(16)17/h2-15,22H,1H3,(H,27,29)/b12-9+ |
| InChIKey | APJFRFHZXKDDPV-FMIVXFBMSA-N |
| XLogP | 4.03 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|