C20H16Cl2FN3O — CID 24529708
(E)-3-(2,4-dichlorophenyl)-N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]prop-2-enamide (PubChem CID 24529708) has the molecular formula C20H16Cl2FN3O and a molecular weight of 404.27 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 24529708 |
| Molecular Formula | C20H16Cl2FN3O |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]prop-2-enamide |
| SMILES | Cn1ccnc1C(NC(=O)/C=C/c1ccc(Cl)cc1Cl)c1cccc(F)c1 |
| InChI | InChI=1S/C20H16Cl2FN3O/c1-26-10-9-24-20(26)19(14-3-2-4-16(23)11-14)25-18(27)8-6-13-5-7-15(21)12-17(13)22/h2-12,19H,1H3,(H,25,27)/b8-6+ |
| InChIKey | OFQFPDRPYQDZMS-SOFGYWHQSA-N |
| XLogP | 4.78 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|