C20H17ClFN3O — CID 9247948
(E)-N-[(S)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 9247948) has the molecular formula C20H17ClFN3O and a molecular weight of 369.83 g/mol. Its IUPAC name is (E)-N-[(S)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[(S)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 9247948 |
| Molecular Formula | C20H17ClFN3O |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | (E)-N-[(S)-(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | Cn1ccnc1[C@@H](NC(=O)/C=C/c1ccc(F)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H17ClFN3O/c1-25-13-12-23-20(25)19(15-5-7-16(21)8-6-15)24-18(26)11-4-14-2-9-17(22)10-3-14/h2-13,19H,1H3,(H,24,26)/b11-4+/t19-/m0/s1 |
| InChIKey | ZYTRJVGJMLOKPX-RRPUDGLYSA-N |
| XLogP | 4.13 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|