C18H16ClN3O2 — CID 46629130
(E)-N-[(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 46629130) has the molecular formula C18H16ClN3O2 and a molecular weight of 341.80 g/mol. Its IUPAC name is (E)-N-[(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 46629130 |
| Molecular Formula | C18H16ClN3O2 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | (E)-N-[(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | Cn1ccnc1C(NC(=O)/C=C/c1ccco1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClN3O2/c1-22-11-10-20-18(22)17(13-4-6-14(19)7-5-13)21-16(23)9-8-15-3-2-12-24-15/h2-12,17H,1H3,(H,21,23)/b9-8+ |
| InChIKey | MNCGKXWHSDSFNP-CMDGGOBGSA-N |
| XLogP | 3.59 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|