C23H19Cl2N3O2 — CID 24532888
(E)-3-(6-chloro-2H-chromen-3-yl)-N-[(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]prop-2-enamide (PubChem CID 24532888) has the molecular formula C23H19Cl2N3O2 and a molecular weight of 440.33 g/mol. Its IUPAC name is (E)-3-(6-chloro-2H-chromen-3-yl)-N-[(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(6-chloro-2H-chromen-3-yl)-N-[(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 24532888 |
| Molecular Formula | C23H19Cl2N3O2 |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | (E)-3-(6-chloro-2H-chromen-3-yl)-N-[(4-chlorophenyl)-(1-methylimidazol-2-yl)methyl]prop-2-enamide |
| SMILES | Cn1ccnc1C(NC(=O)/C=C/C1=Cc2cc(Cl)ccc2OC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H19Cl2N3O2/c1-28-11-10-26-23(28)22(16-3-5-18(24)6-4-16)27-21(29)9-2-15-12-17-13-19(25)7-8-20(17)30-14-15/h2-13,22H,14H2,1H3,(H,27,29)/b9-2+ |
| InChIKey | VQSITXJDDVAVSF-XNWCZRBMSA-N |
| XLogP | 4.96 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|