C20H16ClFN4O3 — CID 55462497
(E)-3-(4-chloro-3-nitrophenyl)-N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]prop-2-enamide (PubChem CID 55462497) has the molecular formula C20H16ClFN4O3 and a molecular weight of 414.82 g/mol. Its IUPAC name is (E)-3-(4-chloro-3-nitrophenyl)-N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(4-chloro-3-nitrophenyl)-N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 55462497 |
| Molecular Formula | C20H16ClFN4O3 |
| Molecular Weight | 414.82 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | (E)-3-(4-chloro-3-nitrophenyl)-N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]prop-2-enamide |
| SMILES | Cn1ccnc1C(NC(=O)/C=C/c1ccc(Cl)c([N+](=O)[O-])c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H16ClFN4O3/c1-25-11-10-23-20(25)19(14-4-6-15(22)7-5-14)24-18(27)9-3-13-2-8-16(21)17(12-13)26(28)29/h2-12,19H,1H3,(H,24,27)/b9-3+ |
| InChIKey | HOYZBYHYRSPJGQ-YCRREMRBSA-N |
| XLogP | 4.04 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.82 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|