C24H26FN3O — CID 97433264
(Z)-3-(4-tert-butylphenyl)-N-[(R)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]prop-2-enamide (PubChem CID 97433264) has the molecular formula C24H26FN3O and a molecular weight of 391.49 g/mol. Its IUPAC name is (Z)-3-(4-tert-butylphenyl)-N-[(R)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]prop-2-enamide.
| Compound Name | (Z)-3-(4-tert-butylphenyl)-N-[(R)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 97433264 |
| Molecular Formula | C24H26FN3O |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | (Z)-3-(4-tert-butylphenyl)-N-[(R)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]prop-2-enamide |
| SMILES | Cn1ccnc1[C@H](NC(=O)/C=C\c1ccc(C(C)(C)C)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C24H26FN3O/c1-24(2,3)19-11-8-17(9-12-19)10-13-21(29)27-22(23-26-14-15-28(23)4)18-6-5-7-20(25)16-18/h5-16,22H,1-4H3,(H,27,29)/b13-10-/t22-/m1/s1 |
| InChIKey | CNGYVULDENODEZ-VPAPRSNLSA-N |
| XLogP | 4.78 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|