C22H25ClFN5O — CID 55453406
(E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]prop-2-enamide (PubChem CID 55453406) has the molecular formula C22H25ClFN5O and a molecular weight of 429.93 g/mol. Its IUPAC name is (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 55453406 |
| Molecular Formula | C22H25ClFN5O |
| Molecular Weight | 429.93 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]prop-2-enamide |
| SMILES | CCCCn1nc(C)c(/C=C/C(=O)NC(c2cccc(F)c2)c2nccn2C)c1Cl |
| InChI | InChI=1S/C22H25ClFN5O/c1-4-5-12-29-21(23)18(15(2)27-29)9-10-19(30)26-20(22-25-11-13-28(22)3)16-7-6-8-17(24)14-16/h6-11,13-14,20H,4-5,12H2,1-3H3,(H,26,30)/b10-9+ |
| InChIKey | RLKJMJZTJJMCAR-MDZDMXLPSA-N |
| XLogP | 4.44 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.93 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|