C23H23FN4O3 — CID 97433417
ethyl (Z)-3-[4-[[(S)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]carbamoylamino]phenyl]prop-2-enoate (PubChem CID 97433417) has the molecular formula C23H23FN4O3 and a molecular weight of 422.46 g/mol. Its IUPAC name is ethyl (Z)-3-[4-[[(S)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]carbamoylamino]phenyl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-[4-[[(S)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]carbamoylamino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 97433417 |
| Molecular Formula | C23H23FN4O3 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | ethyl (Z)-3-[4-[[(S)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]carbamoylamino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C\c1ccc(NC(=O)N[C@@H](c2cccc(F)c2)c2nccn2C)cc1 |
| InChI | InChI=1S/C23H23FN4O3/c1-3-31-20(29)12-9-16-7-10-19(11-8-16)26-23(30)27-21(22-25-13-14-28(22)2)17-5-4-6-18(24)15-17/h4-15,21H,3H2,1-2H3,(H2,26,27,30)/b12-9-/t21-/m0/s1 |
| InChIKey | PUITUQXXLMMDJP-ZAGZISDZSA-N |
| XLogP | 4.05 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|