C22H25FN4O2 — CID 55597992
1-[[4-(ethoxymethyl)phenyl]methyl]-3-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]urea (PubChem CID 55597992) has the molecular formula C22H25FN4O2 and a molecular weight of 396.47 g/mol. Its IUPAC name is 1-[[4-(ethoxymethyl)phenyl]methyl]-3-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]urea.
| Compound Name | 1-[[4-(ethoxymethyl)phenyl]methyl]-3-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]urea |
|---|---|
| PubChem CID | 55597992 |
| Molecular Formula | C22H25FN4O2 |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 1-[[4-(ethoxymethyl)phenyl]methyl]-3-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]urea |
| SMILES | CCOCc1ccc(CNC(=O)NC(c2cccc(F)c2)c2nccn2C)cc1 |
| InChI | InChI=1S/C22H25FN4O2/c1-3-29-15-17-9-7-16(8-10-17)14-25-22(28)26-20(21-24-11-12-27(21)2)18-5-4-6-19(23)13-18/h4-13,20H,3,14-15H2,1-2H3,(H2,25,26,28) |
| InChIKey | WYDHJFSOPLPEKG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |