C21H28FN5O2 — CID 51936762
1-[(R)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-[3-(2-oxoazepan-1-yl)propyl]urea (PubChem CID 51936762) has the molecular formula C21H28FN5O2 and a molecular weight of 401.49 g/mol. Its IUPAC name is 1-[(R)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-[3-(2-oxoazepan-1-yl)propyl]urea.
| Compound Name | 1-[(R)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-[3-(2-oxoazepan-1-yl)propyl]urea |
|---|---|
| PubChem CID | 51936762 |
| Molecular Formula | C21H28FN5O2 |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 1-[(R)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-[3-(2-oxoazepan-1-yl)propyl]urea |
| SMILES | Cn1ccnc1[C@H](NC(=O)NCCCN1CCCCCC1=O)c1cccc(F)c1 |
| InChI | InChI=1S/C21H28FN5O2/c1-26-14-11-23-20(26)19(16-7-5-8-17(22)15-16)25-21(29)24-10-6-13-27-12-4-2-3-9-18(27)28/h5,7-8,11,14-15,19H,2-4,6,9-10,12-13H2,1H3,(H2,24,25,29)/t19-/m1/s1 |
| InChIKey | QNKLHMRHPREGHK-LJQANCHMSA-N |
| XLogP | 2.74 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|