C24H29N5O2 — CID 51936759
1-[(R)-3H-benzimidazol-5-yl(phenyl)methyl]-3-[3-(2-oxoazepan-1-yl)propyl]urea (PubChem CID 51936759) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 1-[(R)-3H-benzimidazol-5-yl(phenyl)methyl]-3-[3-(2-oxoazepan-1-yl)propyl]urea.
| Compound Name | 1-[(R)-3H-benzimidazol-5-yl(phenyl)methyl]-3-[3-(2-oxoazepan-1-yl)propyl]urea |
|---|---|
| PubChem CID | 51936759 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 1-[(R)-3H-benzimidazol-5-yl(phenyl)methyl]-3-[3-(2-oxoazepan-1-yl)propyl]urea |
| SMILES | O=C(NCCCN1CCCCCC1=O)N[C@H](c1ccccc1)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C24H29N5O2/c30-22-10-5-2-6-14-29(22)15-7-13-25-24(31)28-23(18-8-3-1-4-9-18)19-11-12-20-21(16-19)27-17-26-20/h1,3-4,8-9,11-12,16-17,23H,2,5-7,10,13-15H2,(H,26,27)(H2,25,28,31)/t23-/m1/s1 |
| InChIKey | SGWOGAKEZGDSOT-HSZRJFAPSA-N |
| XLogP | 3.74 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|