C19H23FN6O — CID 167831788
1-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]urea (PubChem CID 167831788) has the molecular formula C19H23FN6O and a molecular weight of 370.43 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]urea.
| Compound Name | 1-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]urea |
|---|---|
| PubChem CID | 167831788 |
| Molecular Formula | C19H23FN6O |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 1-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-[3-(5-methyl-1H-pyrazol-4-yl)propyl]urea |
| SMILES | Cc1[nH]ncc1CCCNC(=O)NC(c1cccc(F)c1)c1nccn1C |
| InChI | InChI=1S/C19H23FN6O/c1-13-15(12-23-25-13)6-4-8-22-19(27)24-17(18-21-9-10-26(18)2)14-5-3-7-16(20)11-14/h3,5,7,9-12,17H,4,6,8H2,1-2H3,(H,23,25)(H2,22,24,27) |
| InChIKey | UVFRNOBLPXAUNI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|