C22H25FN4O — CID 42954379
1-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(4-phenylbutyl)urea (PubChem CID 42954379) has the molecular formula C22H25FN4O and a molecular weight of 380.47 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(4-phenylbutyl)urea.
| Compound Name | 1-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(4-phenylbutyl)urea |
|---|---|
| PubChem CID | 42954379 |
| Molecular Formula | C22H25FN4O |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 1-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(4-phenylbutyl)urea |
| SMILES | Cn1ccnc1C(NC(=O)NCCCCc1ccccc1)c1cccc(F)c1 |
| InChI | InChI=1S/C22H25FN4O/c1-27-15-14-24-21(27)20(18-11-7-12-19(23)16-18)26-22(28)25-13-6-5-10-17-8-3-2-4-9-17/h2-4,7-9,11-12,14-16,20H,5-6,10,13H2,1H3,(H2,25,26,28) |
| InChIKey | PWUHHTRENFAVSV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|