C18H23FN4O2 — CID 94149785
1-[(S)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(4-hydroxycyclohexyl)urea (PubChem CID 94149785) has the molecular formula C18H23FN4O2 and a molecular weight of 346.41 g/mol. Its IUPAC name is 1-[(S)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(4-hydroxycyclohexyl)urea.
| Compound Name | 1-[(S)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(4-hydroxycyclohexyl)urea |
|---|---|
| PubChem CID | 94149785 |
| Molecular Formula | C18H23FN4O2 |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1-[(S)-(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(4-hydroxycyclohexyl)urea |
| SMILES | Cn1ccnc1[C@@H](NC(=O)NC1CCC(O)CC1)c1cccc(F)c1 |
| InChI | InChI=1S/C18H23FN4O2/c1-23-10-9-20-17(23)16(12-3-2-4-13(19)11-12)22-18(25)21-14-5-7-15(24)8-6-14/h2-4,9-11,14-16,24H,5-8H2,1H3,(H2,21,22,25)/t14?,15?,16-/m0/s1 |
| InChIKey | WVUQOJBHNNTLDM-GPANFISMSA-N |
| XLogP | 2.25 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |