C18H23FN4O — CID 119837332
3-amino-N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]cyclohexane-1-carboxamide (PubChem CID 119837332) has the molecular formula C18H23FN4O and a molecular weight of 330.41 g/mol. Its IUPAC name is 3-amino-N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]cyclohexane-1-carboxamide.
| Compound Name | 3-amino-N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119837332 |
| Molecular Formula | C18H23FN4O |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 3-amino-N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]cyclohexane-1-carboxamide |
| SMILES | Cn1ccnc1C(NC(=O)C1CCCC(N)C1)c1cccc(F)c1 |
| InChI | InChI=1S/C18H23FN4O/c1-23-9-8-21-17(23)16(12-4-2-6-14(19)10-12)22-18(24)13-5-3-7-15(20)11-13/h2,4,6,8-10,13,15-16H,3,5,7,11,20H2,1H3,(H,22,24) |
| InChIKey | FKUQDIUNACTJMS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |