C22H26FN3O — CID 55453673
N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]adamantane-1-carboxamide (PubChem CID 55453673) has the molecular formula C22H26FN3O and a molecular weight of 367.47 g/mol. Its IUPAC name is N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]adamantane-1-carboxamide.
| Compound Name | N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 55453673 |
| Molecular Formula | C22H26FN3O |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | N-[(3-fluorophenyl)-(1-methylimidazol-2-yl)methyl]adamantane-1-carboxamide |
| SMILES | Cn1ccnc1C(NC(=O)C12CC3CC(CC(C3)C1)C2)c1cccc(F)c1 |
| InChI | InChI=1S/C22H26FN3O/c1-26-6-5-24-20(26)19(17-3-2-4-18(23)10-17)25-21(27)22-11-14-7-15(12-22)9-16(8-14)13-22/h2-6,10,14-16,19H,7-9,11-13H2,1H3,(H,25,27) |
| InChIKey | MDJLXKAZKMHYIJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |