C20H16F3N3O — CID 94232727
(Z)-3-(2,6-difluorophenyl)-N-[(R)-(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]prop-2-enamide (PubChem CID 94232727) has the molecular formula C20H16F3N3O and a molecular weight of 371.36 g/mol. Its IUPAC name is (Z)-3-(2,6-difluorophenyl)-N-[(R)-(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]prop-2-enamide.
| Compound Name | (Z)-3-(2,6-difluorophenyl)-N-[(R)-(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 94232727 |
| Molecular Formula | C20H16F3N3O |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | (Z)-3-(2,6-difluorophenyl)-N-[(R)-(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]prop-2-enamide |
| SMILES | Cn1ccnc1[C@H](NC(=O)/C=C\c1c(F)cccc1F)c1ccccc1F |
| InChI | InChI=1S/C20H16F3N3O/c1-26-12-11-24-20(26)19(14-5-2-3-6-17(14)23)25-18(27)10-9-13-15(21)7-4-8-16(13)22/h2-12,19H,1H3,(H,25,27)/b10-9-/t19-/m1/s1 |
| InChIKey | LRDOJNYOCCIEFL-ZBTAVZRMSA-N |
| XLogP | 3.76 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|