C20H19F2N3O — CID 37295393
3-(2-fluorophenyl)-N-[(S)-(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]propanamide (PubChem CID 37295393) has the molecular formula C20H19F2N3O and a molecular weight of 355.39 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-N-[(S)-(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]propanamide.
| Compound Name | 3-(2-fluorophenyl)-N-[(S)-(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]propanamide |
|---|---|
| PubChem CID | 37295393 |
| Molecular Formula | C20H19F2N3O |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 3-(2-fluorophenyl)-N-[(S)-(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]propanamide |
| SMILES | Cn1ccnc1[C@@H](NC(=O)CCc1ccccc1F)c1ccccc1F |
| InChI | InChI=1S/C20H19F2N3O/c1-25-13-12-23-20(25)19(15-7-3-5-9-17(15)22)24-18(26)11-10-14-6-2-4-8-16(14)21/h2-9,12-13,19H,10-11H2,1H3,(H,24,26)/t19-/m0/s1 |
| InChIKey | ISLNKXGSLBWRKW-IBGZPJMESA-N |
| XLogP | 3.54 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |