C19H17ClFN3O — CID 40953992
2-(2-chlorophenyl)-N-[(R)-(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]acetamide (PubChem CID 40953992) has the molecular formula C19H17ClFN3O and a molecular weight of 357.82 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[(R)-(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]acetamide.
| Compound Name | 2-(2-chlorophenyl)-N-[(R)-(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 40953992 |
| Molecular Formula | C19H17ClFN3O |
| Molecular Weight | 357.82 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[(R)-(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]acetamide |
| SMILES | Cn1ccnc1[C@H](NC(=O)Cc1ccccc1Cl)c1ccccc1F |
| InChI | InChI=1S/C19H17ClFN3O/c1-24-11-10-22-19(24)18(14-7-3-5-9-16(14)21)23-17(25)12-13-6-2-4-8-15(13)20/h2-11,18H,12H2,1H3,(H,23,25)/t18-/m1/s1 |
| InChIKey | NZXDWSHHYZLYCX-GOSISDBHSA-N |
| XLogP | 3.66 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.82 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |