C22H25FN4O — CID 36508070
1-[(R)-(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-[(2S)-4-phenylbutan-2-yl]urea (PubChem CID 36508070) has the molecular formula C22H25FN4O and a molecular weight of 380.47 g/mol. Its IUPAC name is 1-[(R)-(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-[(2S)-4-phenylbutan-2-yl]urea.
| Compound Name | 1-[(R)-(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-[(2S)-4-phenylbutan-2-yl]urea |
|---|---|
| PubChem CID | 36508070 |
| Molecular Formula | C22H25FN4O |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 1-[(R)-(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-[(2S)-4-phenylbutan-2-yl]urea |
| SMILES | C[C@@H](CCc1ccccc1)NC(=O)N[C@H](c1ccccc1F)c1nccn1C |
| InChI | InChI=1S/C22H25FN4O/c1-16(12-13-17-8-4-3-5-9-17)25-22(28)26-20(21-24-14-15-27(21)2)18-10-6-7-11-19(18)23/h3-11,14-16,20H,12-13H2,1-2H3,(H2,25,26,28)/t16-,20+/m0/s1 |
| InChIKey | KUPMHRXHLFBGFI-OXJNMPFZSA-N |
| XLogP | 3.97 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |