C20H20ClFN4O — CID 36505789
1-[2-(4-chlorophenyl)ethyl]-3-[(S)-(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]urea (PubChem CID 36505789) has the molecular formula C20H20ClFN4O and a molecular weight of 386.86 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)ethyl]-3-[(S)-(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]urea.
| Compound Name | 1-[2-(4-chlorophenyl)ethyl]-3-[(S)-(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]urea |
|---|---|
| PubChem CID | 36505789 |
| Molecular Formula | C20H20ClFN4O |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 1-[2-(4-chlorophenyl)ethyl]-3-[(S)-(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]urea |
| SMILES | Cn1ccnc1[C@@H](NC(=O)NCCc1ccc(Cl)cc1)c1ccccc1F |
| InChI | InChI=1S/C20H20ClFN4O/c1-26-13-12-23-19(26)18(16-4-2-3-5-17(16)22)25-20(27)24-11-10-14-6-8-15(21)9-7-14/h2-9,12-13,18H,10-11H2,1H3,(H2,24,25,27)/t18-/m0/s1 |
| InChIKey | BMTOWJNVANTTJH-SFHVURJKSA-N |
| XLogP | 3.84 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |