C12H14N2O5S — CID 7974456
[(1S)-1-cyanoethyl] 4-methoxy-3-(methylsulfamoyl)benzoate (PubChem CID 7974456) has the molecular formula C12H14N2O5S and a molecular weight of 298.32 g/mol. Its IUPAC name is [(1S)-1-cyanoethyl] 4-methoxy-3-(methylsulfamoyl)benzoate.
| Compound Name | [(1S)-1-cyanoethyl] 4-methoxy-3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7974456 |
| Molecular Formula | C12H14N2O5S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | [(1S)-1-cyanoethyl] 4-methoxy-3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cc(C(=O)O[C@@H](C)C#N)ccc1OC |
| InChI | InChI=1S/C12H14N2O5S/c1-8(7-13)19-12(15)9-4-5-10(18-3)11(6-9)20(16,17)14-2/h4-6,8,14H,1-3H3/t8-/m0/s1 |
| InChIKey | SHKIEPOPVHWQBF-QMMMGPOBSA-N |
| XLogP | 0.67 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |