About [(1S)-1-cyanoethyl] 4-fluoro-3-[(2-methoxyphenyl)sulfamoyl]benzoate
[(1S)-1-cyanoethyl] 4-fluoro-3-[(2-methoxyphenyl)sulfamoyl]benzoate (PubChem CID 31093140) has the molecular formula C17H15FN2O5S
and a molecular weight of 378.38 g/mol. Its IUPAC name is [(1S)-1-cyanoethyl] 4-fluoro-3-[(2-methoxyphenyl)sulfamoyl]benzoate.
Molecular Properties
| Compound Name | [(1S)-1-cyanoethyl] 4-fluoro-3-[(2-methoxyphenyl)sulfamoyl]benzoate |
| PubChem CID | 31093140 |
| Molecular Formula | C17H15FN2O5S |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | [(1S)-1-cyanoethyl] 4-fluoro-3-[(2-methoxyphenyl)sulfamoyl]benzoate |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc(C(=O)O[C@@H](C)C#N)ccc1F |
| InChI | InChI=1S/C17H15FN2O5S/c1-11(10-19)25-17(21)12-7-8-13(18)16(9-12)26(22,23)20-14-5-3-4-6-15(14)24-2/h3-9,11,20H,1-2H3/t11-/m0/s1 |
| InChIKey | PWDWWXSMPSUIKG-NSHDSACASA-N |
| XLogP | 2.70 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(1S)-1-cyanoethyl] 4-fluoro-3-[(2-methoxyphenyl)sulfamoyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-cyanoethyl] 4-fluoro-3-[(2-methoxyphenyl)sulfamoyl]benzoate?
The IUPAC name of [(1S)-1-cyanoethyl] 4-fluoro-3-[(2-methoxyphenyl)sulfamoyl]benzoate (CID 31093140) is [(1S)-1-cyanoethyl] 4-fluoro-3-[(2-methoxyphenyl)sulfamoyl]benzoate.
What is the SMILES notation for [(1S)-1-cyanoethyl] 4-fluoro-3-[(2-methoxyphenyl)sulfamoyl]benzoate?
The canonical SMILES for [(1S)-1-cyanoethyl] 4-fluoro-3-[(2-methoxyphenyl)sulfamoyl]benzoate is COc1ccccc1NS(=O)(=O)c1cc(C(=O)O[C@@H](C)C#N)ccc1F.
What is the InChIKey of [(1S)-1-cyanoethyl] 4-fluoro-3-[(2-methoxyphenyl)sulfamoyl]benzoate?
The InChIKey is PWDWWXSMPSUIKG-NSHDSACASA-N. The full InChI is InChI=1S/C17H15FN2O5S/c1-11(10-19)25-17(21)12-7-8-13(18)16(9-12)26(22,23)20-14-5-3-4-6-15(14)24-2/h3-9,11,20H,1-2H3/t11-/m0/s1.
What are the key properties of [(1S)-1-cyanoethyl] 4-fluoro-3-[(2-methoxyphenyl)sulfamoyl]benzoate?
[(1S)-1-cyanoethyl] 4-fluoro-3-[(2-methoxyphenyl)sulfamoyl]benzoate has a molecular weight of 378.38 g/mol, XLogP of 2.70, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-cyanoethyl] 4-fluoro-3-[(2-methoxyphenyl)sulfamoyl]benzoate is sourced from PubChem (CID 31093140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).