C18H12FN3OS — CID 97051265
N-[(S)-cyano-(2-fluorophenyl)methyl]-4-(1,3-thiazol-4-yl)benzamide (PubChem CID 97051265) has the molecular formula C18H12FN3OS and a molecular weight of 337.38 g/mol. Its IUPAC name is N-[(S)-cyano-(2-fluorophenyl)methyl]-4-(1,3-thiazol-4-yl)benzamide.
| Compound Name | N-[(S)-cyano-(2-fluorophenyl)methyl]-4-(1,3-thiazol-4-yl)benzamide |
|---|---|
| PubChem CID | 97051265 |
| Molecular Formula | C18H12FN3OS |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | N-[(S)-cyano-(2-fluorophenyl)methyl]-4-(1,3-thiazol-4-yl)benzamide |
| SMILES | N#C[C@@H](NC(=O)c1ccc(-c2cscn2)cc1)c1ccccc1F |
| InChI | InChI=1S/C18H12FN3OS/c19-15-4-2-1-3-14(15)16(9-20)22-18(23)13-7-5-12(6-8-13)17-10-24-11-21-17/h1-8,10-11,16H,(H,22,23)/t16-/m1/s1 |
| InChIKey | IEOHKOURBNIBCK-MRXNPFEDSA-N |
| XLogP | 3.94 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |