C23H20FN3O3S — CID 56515140
N-[cyano-(2-fluorophenyl)methyl]-4-[methyl-(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 56515140) has the molecular formula C23H20FN3O3S and a molecular weight of 437.50 g/mol. Its IUPAC name is N-[cyano-(2-fluorophenyl)methyl]-4-[methyl-(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-[cyano-(2-fluorophenyl)methyl]-4-[methyl-(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 56515140 |
| Molecular Formula | C23H20FN3O3S |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | N-[cyano-(2-fluorophenyl)methyl]-4-[methyl-(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2ccc(C(=O)NC(C#N)c3ccccc3F)cc2)cc1 |
| InChI | InChI=1S/C23H20FN3O3S/c1-16-7-13-19(14-8-16)31(29,30)27(2)18-11-9-17(10-12-18)23(28)26-22(15-25)20-5-3-4-6-21(20)24/h3-14,22H,1-2H3,(H,26,28) |
| InChIKey | MIUWLOWAYOJYHE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |