C14H9ClFN3O — CID 96568893
N-[(S)-(2-chlorophenyl)-cyanomethyl]-6-fluoropyridine-3-carboxamide (PubChem CID 96568893) has the molecular formula C14H9ClFN3O and a molecular weight of 289.70 g/mol. Its IUPAC name is N-[(S)-(2-chlorophenyl)-cyanomethyl]-6-fluoropyridine-3-carboxamide.
| Compound Name | N-[(S)-(2-chlorophenyl)-cyanomethyl]-6-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 96568893 |
| Molecular Formula | C14H9ClFN3O |
| Molecular Weight | 289.70 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | N-[(S)-(2-chlorophenyl)-cyanomethyl]-6-fluoropyridine-3-carboxamide |
| SMILES | N#C[C@@H](NC(=O)c1ccc(F)nc1)c1ccccc1Cl |
| InChI | InChI=1S/C14H9ClFN3O/c15-11-4-2-1-3-10(11)12(7-17)19-14(20)9-5-6-13(16)18-8-9/h1-6,8,12H,(H,19,20)/t12-/m1/s1 |
| InChIKey | MEOFLPARZDHNBT-GFCCVEGCSA-N |
| XLogP | 2.87 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.70 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|