C12H11ClN2O3 — CID 70211689
4-[[(2-chlorophenyl)-cyanomethyl]amino]-4-oxobutanoic acid (PubChem CID 70211689) has the molecular formula C12H11ClN2O3 and a molecular weight of 266.68 g/mol. Its IUPAC name is 4-[[(2-chlorophenyl)-cyanomethyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[(2-chlorophenyl)-cyanomethyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 70211689 |
| Molecular Formula | C12H11ClN2O3 |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 4-[[(2-chlorophenyl)-cyanomethyl]amino]-4-oxobutanoic acid |
| SMILES | N#CC(NC(=O)CCC(=O)O)c1ccccc1Cl |
| InChI | InChI=1S/C12H11ClN2O3/c13-9-4-2-1-3-8(9)10(7-14)15-11(16)5-6-12(17)18/h1-4,10H,5-6H2,(H,15,16)(H,17,18) |
| InChIKey | WTZTWVYEBZLWER-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |