C12H15ClN2O — CID 82019870
2-(2-chlorophenyl)-2-[(1-hydroxy-2-methylpropan-2-yl)amino]acetonitrile (PubChem CID 82019870) has the molecular formula C12H15ClN2O and a molecular weight of 238.72 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-2-[(1-hydroxy-2-methylpropan-2-yl)amino]acetonitrile.
| Compound Name | 2-(2-chlorophenyl)-2-[(1-hydroxy-2-methylpropan-2-yl)amino]acetonitrile |
|---|---|
| PubChem CID | 82019870 |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 2-(2-chlorophenyl)-2-[(1-hydroxy-2-methylpropan-2-yl)amino]acetonitrile |
| SMILES | CC(C)(CO)NC(C#N)c1ccccc1Cl |
| InChI | InChI=1S/C12H15ClN2O/c1-12(2,8-16)15-11(7-14)9-5-3-4-6-10(9)13/h3-6,11,15-16H,8H2,1-2H3 |
| InChIKey | GYXVPGOUKIHQHW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |