C22H16F2N2O2 — CID 56572178
N-[cyano-(2-fluorophenyl)methyl]-3-[(4-fluorophenyl)methoxy]benzamide (PubChem CID 56572178) has the molecular formula C22H16F2N2O2 and a molecular weight of 378.38 g/mol. Its IUPAC name is N-[cyano-(2-fluorophenyl)methyl]-3-[(4-fluorophenyl)methoxy]benzamide.
| Compound Name | N-[cyano-(2-fluorophenyl)methyl]-3-[(4-fluorophenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 56572178 |
| Molecular Formula | C22H16F2N2O2 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-[cyano-(2-fluorophenyl)methyl]-3-[(4-fluorophenyl)methoxy]benzamide |
| SMILES | N#CC(NC(=O)c1cccc(OCc2ccc(F)cc2)c1)c1ccccc1F |
| InChI | InChI=1S/C22H16F2N2O2/c23-17-10-8-15(9-11-17)14-28-18-5-3-4-16(12-18)22(27)26-21(13-25)19-6-1-2-7-20(19)24/h1-12,21H,14H2,(H,26,27) |
| InChIKey | BLHMOYQUIMYNCY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |