C22H19FN2O3 — CID 31857522
N-[4-(2-amino-2-oxoethyl)phenyl]-3-[(4-fluorophenyl)methoxy]benzamide (PubChem CID 31857522) has the molecular formula C22H19FN2O3 and a molecular weight of 378.40 g/mol. Its IUPAC name is N-[4-(2-amino-2-oxoethyl)phenyl]-3-[(4-fluorophenyl)methoxy]benzamide.
| Compound Name | N-[4-(2-amino-2-oxoethyl)phenyl]-3-[(4-fluorophenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 31857522 |
| Molecular Formula | C22H19FN2O3 |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-[4-(2-amino-2-oxoethyl)phenyl]-3-[(4-fluorophenyl)methoxy]benzamide |
| SMILES | NC(=O)Cc1ccc(NC(=O)c2cccc(OCc3ccc(F)cc3)c2)cc1 |
| InChI | InChI=1S/C22H19FN2O3/c23-18-8-4-16(5-9-18)14-28-20-3-1-2-17(13-20)22(27)25-19-10-6-15(7-11-19)12-21(24)26/h1-11,13H,12,14H2,(H2,24,26)(H,25,27) |
| InChIKey | DXSVKKWLWPZDNJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |