C23H19FN2O4 — CID 108927597
[3-[[4-[[2-(4-fluorophenyl)acetyl]amino]phenyl]carbamoyl]phenyl] acetate (PubChem CID 108927597) has the molecular formula C23H19FN2O4 and a molecular weight of 406.41 g/mol. Its IUPAC name is [3-[[4-[[2-(4-fluorophenyl)acetyl]amino]phenyl]carbamoyl]phenyl] acetate.
| Compound Name | [3-[[4-[[2-(4-fluorophenyl)acetyl]amino]phenyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108927597 |
| Molecular Formula | C23H19FN2O4 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | [3-[[4-[[2-(4-fluorophenyl)acetyl]amino]phenyl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)Nc2ccc(NC(=O)Cc3ccc(F)cc3)cc2)c1 |
| InChI | InChI=1S/C23H19FN2O4/c1-15(27)30-21-4-2-3-17(14-21)23(29)26-20-11-9-19(10-12-20)25-22(28)13-16-5-7-18(24)8-6-16/h2-12,14H,13H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | MYDBNQMEDRRDAR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|