C24H21FN2O4 — CID 108927732
[3-[[4-[3-(3-fluorophenyl)propanoylamino]phenyl]carbamoyl]phenyl] acetate (PubChem CID 108927732) has the molecular formula C24H21FN2O4 and a molecular weight of 420.44 g/mol. Its IUPAC name is [3-[[4-[3-(3-fluorophenyl)propanoylamino]phenyl]carbamoyl]phenyl] acetate.
| Compound Name | [3-[[4-[3-(3-fluorophenyl)propanoylamino]phenyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 108927732 |
| Molecular Formula | C24H21FN2O4 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | [3-[[4-[3-(3-fluorophenyl)propanoylamino]phenyl]carbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)Nc2ccc(NC(=O)CCc3cccc(F)c3)cc2)c1 |
| InChI | InChI=1S/C24H21FN2O4/c1-16(28)31-22-7-3-5-18(15-22)24(30)27-21-11-9-20(10-12-21)26-23(29)13-8-17-4-2-6-19(25)14-17/h2-7,9-12,14-15H,8,13H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | HAEPVYHOMNSKBD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|