C21H21F2N3O4S — CID 56536959
N-[cyano-(2,4-difluorophenyl)methyl]-4-ethyl-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 56536959) has the molecular formula C21H21F2N3O4S and a molecular weight of 449.48 g/mol. Its IUPAC name is N-[cyano-(2,4-difluorophenyl)methyl]-4-ethyl-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[cyano-(2,4-difluorophenyl)methyl]-4-ethyl-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 56536959 |
| Molecular Formula | C21H21F2N3O4S |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | N-[cyano-(2,4-difluorophenyl)methyl]-4-ethyl-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | CCc1ccc(C(=O)NC(C#N)c2ccc(F)cc2F)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H21F2N3O4S/c1-2-14-3-4-15(11-20(14)31(28,29)26-7-9-30-10-8-26)21(27)25-19(13-24)17-6-5-16(22)12-18(17)23/h3-6,11-12,19H,2,7-10H2,1H3,(H,25,27) |
| InChIKey | FBKQERUAPMBUEU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |