C23H30N2O6S — CID 55579646
N-[1-(2,4-dimethoxyphenyl)ethyl]-4-ethyl-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 55579646) has the molecular formula C23H30N2O6S and a molecular weight of 462.57 g/mol. Its IUPAC name is N-[1-(2,4-dimethoxyphenyl)ethyl]-4-ethyl-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[1-(2,4-dimethoxyphenyl)ethyl]-4-ethyl-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55579646 |
| Molecular Formula | C23H30N2O6S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | N-[1-(2,4-dimethoxyphenyl)ethyl]-4-ethyl-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | CCc1ccc(C(=O)NC(C)c2ccc(OC)cc2OC)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C23H30N2O6S/c1-5-17-6-7-18(14-22(17)32(27,28)25-10-12-31-13-11-25)23(26)24-16(2)20-9-8-19(29-3)15-21(20)30-4/h6-9,14-16H,5,10-13H2,1-4H3,(H,24,26) |
| InChIKey | YDHKYOYLSKQKGK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |