C19H18F3N3O3S — CID 56584375
N-[cyano-(2,4-difluorophenyl)methyl]-5-(diethylsulfamoyl)-2-fluorobenzamide (PubChem CID 56584375) has the molecular formula C19H18F3N3O3S and a molecular weight of 425.43 g/mol. Its IUPAC name is N-[cyano-(2,4-difluorophenyl)methyl]-5-(diethylsulfamoyl)-2-fluorobenzamide.
| Compound Name | N-[cyano-(2,4-difluorophenyl)methyl]-5-(diethylsulfamoyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 56584375 |
| Molecular Formula | C19H18F3N3O3S |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | N-[cyano-(2,4-difluorophenyl)methyl]-5-(diethylsulfamoyl)-2-fluorobenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)NC(C#N)c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C19H18F3N3O3S/c1-3-25(4-2)29(27,28)13-6-8-16(21)15(10-13)19(26)24-18(11-23)14-7-5-12(20)9-17(14)22/h5-10,18H,3-4H2,1-2H3,(H,24,26) |
| InChIKey | WLHPFSPVJFOSFA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |