C19H21F2N3O5S — CID 55502416
N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]-4-(2-methoxyethylsulfamoyl)benzamide (PubChem CID 55502416) has the molecular formula C19H21F2N3O5S and a molecular weight of 441.46 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]-4-(2-methoxyethylsulfamoyl)benzamide.
| Compound Name | N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]-4-(2-methoxyethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55502416 |
| Molecular Formula | C19H21F2N3O5S |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]-4-(2-methoxyethylsulfamoyl)benzamide |
| SMILES | CNC(=O)C(NC(=O)c1ccc(S(=O)(=O)NCCOC)cc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H21F2N3O5S/c1-22-19(26)17(13-5-8-15(20)16(21)11-13)24-18(25)12-3-6-14(7-4-12)30(27,28)23-9-10-29-2/h3-8,11,17,23H,9-10H2,1-2H3,(H,22,26)(H,24,25) |
| InChIKey | CORZYXVDFPLASI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|