C18H20F2N2O5S — CID 55652546
N-[2-(2,4-difluorophenyl)-2-hydroxyethyl]-3-(2-methoxyethylsulfamoyl)benzamide (PubChem CID 55652546) has the molecular formula C18H20F2N2O5S and a molecular weight of 414.43 g/mol. Its IUPAC name is N-[2-(2,4-difluorophenyl)-2-hydroxyethyl]-3-(2-methoxyethylsulfamoyl)benzamide.
| Compound Name | N-[2-(2,4-difluorophenyl)-2-hydroxyethyl]-3-(2-methoxyethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55652546 |
| Molecular Formula | C18H20F2N2O5S |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | N-[2-(2,4-difluorophenyl)-2-hydroxyethyl]-3-(2-methoxyethylsulfamoyl)benzamide |
| SMILES | COCCNS(=O)(=O)c1cccc(C(=O)NCC(O)c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C18H20F2N2O5S/c1-27-8-7-22-28(25,26)14-4-2-3-12(9-14)18(24)21-11-17(23)15-6-5-13(19)10-16(15)20/h2-6,9-10,17,22-23H,7-8,11H2,1H3,(H,21,24) |
| InChIKey | UHHSFTZNXNWYAP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|