C17H19ClN2O3 — CID 7133261
[(3R)-3-cyano-4-imino-2-oxopentyl] (2S)-2-(4-chlorophenyl)-3-methylbutanoate (PubChem CID 7133261) has the molecular formula C17H19ClN2O3 and a molecular weight of 334.80 g/mol. Its IUPAC name is [(3R)-3-cyano-4-imino-2-oxopentyl] (2S)-2-(4-chlorophenyl)-3-methylbutanoate.
| Compound Name | [(3R)-3-cyano-4-imino-2-oxopentyl] (2S)-2-(4-chlorophenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 7133261 |
| Molecular Formula | C17H19ClN2O3 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | [(3R)-3-cyano-4-imino-2-oxopentyl] (2S)-2-(4-chlorophenyl)-3-methylbutanoate |
| SMILES | [H]/N=C(\C)[C@H](C#N)C(=O)COC(=O)[C@H](c1ccc(Cl)cc1)C(C)C |
| InChI | InChI=1S/C17H19ClN2O3/c1-10(2)16(12-4-6-13(18)7-5-12)17(22)23-9-15(21)14(8-19)11(3)20/h4-7,10,14,16,20H,9H2,1-3H3/b20-11+/t14-,16-/m0/s1 |
| InChIKey | HGRNQVGWDWNWNI-KWFIRXJUSA-N |
| XLogP | 3.37 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|