C15H16N2O3 — CID 7247440
[(3R)-3-cyano-4-imino-2-oxopentyl] 2,5-dimethylbenzoate (PubChem CID 7247440) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is [(3R)-3-cyano-4-imino-2-oxopentyl] 2,5-dimethylbenzoate.
| Compound Name | [(3R)-3-cyano-4-imino-2-oxopentyl] 2,5-dimethylbenzoate |
|---|---|
| PubChem CID | 7247440 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | [(3R)-3-cyano-4-imino-2-oxopentyl] 2,5-dimethylbenzoate |
| SMILES | [H]/N=C(\C)[C@H](C#N)C(=O)COC(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C15H16N2O3/c1-9-4-5-10(2)12(6-9)15(19)20-8-14(18)13(7-16)11(3)17/h4-6,13,17H,8H2,1-3H3/b17-11+/t13-/m0/s1 |
| InChIKey | HTEWQXPBUTWTRB-HNEYUBDGSA-N |
| XLogP | 2.21 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|