C22H16FN3O3 — CID 7761509
(3-cyano-4-imino-2-oxopentyl) 2-(4-fluorophenyl)quinoline-4-carboxylate (PubChem CID 7761509) has the molecular formula C22H16FN3O3 and a molecular weight of 389.39 g/mol. Its IUPAC name is (3-cyano-4-imino-2-oxopentyl) 2-(4-fluorophenyl)quinoline-4-carboxylate.
| Compound Name | (3-cyano-4-imino-2-oxopentyl) 2-(4-fluorophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 7761509 |
| Molecular Formula | C22H16FN3O3 |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | (3-cyano-4-imino-2-oxopentyl) 2-(4-fluorophenyl)quinoline-4-carboxylate |
| SMILES | [H]/N=C(\C)C(C#N)C(=O)COC(=O)c1cc(-c2ccc(F)cc2)nc2ccccc12 |
| InChI | InChI=1S/C22H16FN3O3/c1-13(25)18(11-24)21(27)12-29-22(28)17-10-20(14-6-8-15(23)9-7-14)26-19-5-3-2-4-16(17)19/h2-10,18,25H,12H2,1H3/b25-13+ |
| InChIKey | SEJBCRCZVVISPQ-DHRITJCHSA-N |
| XLogP | 3.95 |
| TPSA | 103.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|