C20H15NO2 — CID 91689203
prop-2-ynyl 2-(4-methylphenyl)quinoline-4-carboxylate (PubChem CID 91689203) has the molecular formula C20H15NO2 and a molecular weight of 301.35 g/mol. Its IUPAC name is prop-2-ynyl 2-(4-methylphenyl)quinoline-4-carboxylate.
| Compound Name | prop-2-ynyl 2-(4-methylphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 91689203 |
| Molecular Formula | C20H15NO2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | prop-2-ynyl 2-(4-methylphenyl)quinoline-4-carboxylate |
| SMILES | C#CCOC(=O)c1cc(-c2ccc(C)cc2)nc2ccccc12 |
| InChI | InChI=1S/C20H15NO2/c1-3-12-23-20(22)17-13-19(15-10-8-14(2)9-11-15)21-18-7-5-4-6-16(17)18/h1,4-11,13H,12H2,2H3 |
| InChIKey | YJHRAMBRAXKMLZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|