C20H15N3O3S — CID 7649696
(3-cyano-4-imino-2-oxopentyl) 2-thiophen-2-ylquinoline-4-carboxylate (PubChem CID 7649696) has the molecular formula C20H15N3O3S and a molecular weight of 377.43 g/mol. Its IUPAC name is (3-cyano-4-imino-2-oxopentyl) 2-thiophen-2-ylquinoline-4-carboxylate.
| Compound Name | (3-cyano-4-imino-2-oxopentyl) 2-thiophen-2-ylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 7649696 |
| Molecular Formula | C20H15N3O3S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | (3-cyano-4-imino-2-oxopentyl) 2-thiophen-2-ylquinoline-4-carboxylate |
| SMILES | [H]/N=C(\C)C(C#N)C(=O)COC(=O)c1cc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C20H15N3O3S/c1-12(22)15(10-21)18(24)11-26-20(25)14-9-17(19-7-4-8-27-19)23-16-6-3-2-5-13(14)16/h2-9,15,22H,11H2,1H3/b22-12+ |
| InChIKey | OFKQGOCESGYNCH-WSDLNYQXSA-N |
| XLogP | 3.87 |
| TPSA | 103.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|