C21H28N2O4 — CID 7826639
(3-cyano-4-imino-2-oxopentyl) 3,5-ditert-butyl-2-hydroxybenzoate (PubChem CID 7826639) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is (3-cyano-4-imino-2-oxopentyl) 3,5-ditert-butyl-2-hydroxybenzoate.
| Compound Name | (3-cyano-4-imino-2-oxopentyl) 3,5-ditert-butyl-2-hydroxybenzoate |
|---|---|
| PubChem CID | 7826639 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | (3-cyano-4-imino-2-oxopentyl) 3,5-ditert-butyl-2-hydroxybenzoate |
| SMILES | [H]/N=C(\C)C(C#N)C(=O)COC(=O)c1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C21H28N2O4/c1-12(23)15(10-22)17(24)11-27-19(26)14-8-13(20(2,3)4)9-16(18(14)25)21(5,6)7/h8-9,15,23,25H,11H2,1-7H3/b23-12+ |
| InChIKey | NHSPIVVNXXJWRW-FSJBWODESA-N |
| XLogP | 3.89 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|