About (3-cyano-4-imino-2-oxopentyl) 3-pyrrol-1-ylbenzoate
(3-cyano-4-imino-2-oxopentyl) 3-pyrrol-1-ylbenzoate (PubChem CID 7542521) has the molecular formula C17H15N3O3
and a molecular weight of 309.33 g/mol. Its IUPAC name is (3-cyano-4-imino-2-oxopentyl) 3-pyrrol-1-ylbenzoate.
Molecular Properties
| Compound Name | (3-cyano-4-imino-2-oxopentyl) 3-pyrrol-1-ylbenzoate |
| PubChem CID | 7542521 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (3-cyano-4-imino-2-oxopentyl) 3-pyrrol-1-ylbenzoate |
| SMILES | [H]/N=C(\C)C(C#N)C(=O)COC(=O)c1cccc(-n2cccc2)c1 |
| InChI | InChI=1S/C17H15N3O3/c1-12(19)15(10-18)16(21)11-23-17(22)13-5-4-6-14(9-13)20-7-2-3-8-20/h2-9,15,19H,11H2,1H3/b19-12+ |
| InChIKey | LGJOCRJGTDLCCS-XDHOZWIPSA-N |
| XLogP | 2.38 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3-cyano-4-imino-2-oxopentyl) 3-pyrrol-1-ylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyano-4-imino-2-oxopentyl) 3-pyrrol-1-ylbenzoate?
The IUPAC name of (3-cyano-4-imino-2-oxopentyl) 3-pyrrol-1-ylbenzoate (CID 7542521) is (3-cyano-4-imino-2-oxopentyl) 3-pyrrol-1-ylbenzoate.
What is the SMILES notation for (3-cyano-4-imino-2-oxopentyl) 3-pyrrol-1-ylbenzoate?
The canonical SMILES for (3-cyano-4-imino-2-oxopentyl) 3-pyrrol-1-ylbenzoate is [H]/N=C(\C)C(C#N)C(=O)COC(=O)c1cccc(-n2cccc2)c1.
What is the InChIKey of (3-cyano-4-imino-2-oxopentyl) 3-pyrrol-1-ylbenzoate?
The InChIKey is LGJOCRJGTDLCCS-XDHOZWIPSA-N. The full InChI is InChI=1S/C17H15N3O3/c1-12(19)15(10-18)16(21)11-23-17(22)13-5-4-6-14(9-13)20-7-2-3-8-20/h2-9,15,19H,11H2,1H3/b19-12+.
What are the key properties of (3-cyano-4-imino-2-oxopentyl) 3-pyrrol-1-ylbenzoate?
(3-cyano-4-imino-2-oxopentyl) 3-pyrrol-1-ylbenzoate has a molecular weight of 309.33 g/mol, XLogP of 2.38, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyano-4-imino-2-oxopentyl) 3-pyrrol-1-ylbenzoate is sourced from PubChem (CID 7542521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).