C19H16N4O3S — CID 8000889
[(3R)-3-cyano-4-imino-2-oxopentyl] 3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carboxylate (PubChem CID 8000889) has the molecular formula C19H16N4O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is [(3R)-3-cyano-4-imino-2-oxopentyl] 3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carboxylate.
| Compound Name | [(3R)-3-cyano-4-imino-2-oxopentyl] 3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 8000889 |
| Molecular Formula | C19H16N4O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | [(3R)-3-cyano-4-imino-2-oxopentyl] 3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carboxylate |
| SMILES | [H]/N=C(\C)[C@H](C#N)C(=O)COC(=O)c1cc2c(C)nn(-c3ccccc3)c2s1 |
| InChI | InChI=1S/C19H16N4O3S/c1-11(21)15(9-20)16(24)10-26-19(25)17-8-14-12(2)22-23(18(14)27-17)13-6-4-3-5-7-13/h3-8,15,21H,10H2,1-2H3/b21-11+/t15-/m0/s1 |
| InChIKey | FOLRQYMIYRYXKG-FPQGOQEYSA-N |
| XLogP | 3.30 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|