C21H20N4O3S — CID 7247388
[(3S)-3-cyano-4-imino-2-oxopentyl] 3-methyl-1-[(4-methylphenyl)methyl]thieno[3,2-d]pyrazole-5-carboxylate (PubChem CID 7247388) has the molecular formula C21H20N4O3S and a molecular weight of 408.48 g/mol. Its IUPAC name is [(3S)-3-cyano-4-imino-2-oxopentyl] 3-methyl-1-[(4-methylphenyl)methyl]thieno[3,2-d]pyrazole-5-carboxylate.
| Compound Name | [(3S)-3-cyano-4-imino-2-oxopentyl] 3-methyl-1-[(4-methylphenyl)methyl]thieno[3,2-d]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 7247388 |
| Molecular Formula | C21H20N4O3S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | [(3S)-3-cyano-4-imino-2-oxopentyl] 3-methyl-1-[(4-methylphenyl)methyl]thieno[3,2-d]pyrazole-5-carboxylate |
| SMILES | [H]/N=C(\C)[C@@H](C#N)C(=O)COC(=O)c1cc2c(C)nn(Cc3ccc(C)cc3)c2s1 |
| InChI | InChI=1S/C21H20N4O3S/c1-12-4-6-15(7-5-12)10-25-20-16(14(3)24-25)8-19(29-20)21(27)28-11-18(26)17(9-22)13(2)23/h4-8,17,23H,10-11H2,1-3H3/b23-13+/t17-/m1/s1 |
| InChIKey | NBUKESQFZKBLCL-YXUUZYBBSA-N |
| XLogP | 3.67 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|