C19H25N3O5S — CID 7882569
[(3S)-3-cyano-4-imino-2-oxopentyl] (2S)-2-[(3,4-dimethylphenyl)sulfonylamino]-3-methylbutanoate (PubChem CID 7882569) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is [(3S)-3-cyano-4-imino-2-oxopentyl] (2S)-2-[(3,4-dimethylphenyl)sulfonylamino]-3-methylbutanoate.
| Compound Name | [(3S)-3-cyano-4-imino-2-oxopentyl] (2S)-2-[(3,4-dimethylphenyl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 7882569 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | [(3S)-3-cyano-4-imino-2-oxopentyl] (2S)-2-[(3,4-dimethylphenyl)sulfonylamino]-3-methylbutanoate |
| SMILES | [H]/N=C(\C)[C@@H](C#N)C(=O)COC(=O)[C@@H](NS(=O)(=O)c1ccc(C)c(C)c1)C(C)C |
| InChI | InChI=1S/C19H25N3O5S/c1-11(2)18(19(24)27-10-17(23)16(9-20)14(5)21)22-28(25,26)15-7-6-12(3)13(4)8-15/h6-8,11,16,18,21-22H,10H2,1-5H3/b21-14+/t16-,18+/m1/s1 |
| InChIKey | LNCBAFBYVAHTKN-RUAFXOIQSA-N |
| XLogP | 1.90 |
| TPSA | 137.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|